About 4-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-ol
4-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-ol (PubChem CID 139748942) has the molecular formula C15H14O2
and a molecular weight of 226.28 g/mol. Its IUPAC name is 4-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-ol.
Molecular Properties
| Compound Name | 4-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-ol |
| PubChem CID | 139748942 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 4-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-ol |
| SMILES | Cc1cccc2c1OCc1ccccc1C2O |
| InChI | InChI=1S/C15H14O2/c1-10-5-4-8-13-14(16)12-7-3-2-6-11(12)9-17-15(10)13/h2-8,14,16H,9H2,1H3 |
| InChIKey | HNNXMXSFCOBZPF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-ol?
The IUPAC name of 4-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-ol (CID 139748942) is 4-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-ol.
What is the SMILES notation for 4-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-ol?
The canonical SMILES for 4-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-ol is Cc1cccc2c1OCc1ccccc1C2O.
What is the InChIKey of 4-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-ol?
The InChIKey is HNNXMXSFCOBZPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O2/c1-10-5-4-8-13-14(16)12-7-3-2-6-11(12)9-17-15(10)13/h2-8,14,16H,9H2,1H3.
What are the key properties of 4-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-ol?
4-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-ol has a molecular weight of 226.28 g/mol, XLogP of 2.97, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-6,11-dihydrobenzo[c][1]benzoxepin-11-ol is sourced from PubChem (CID 139748942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).