C37H37N5O6S — CID 139749194
3-[2-[(2S)-2-[[(2R)-2-[(3,5-dimethylbenzoyl)-methylamino]-3-(4-thiophen-3-ylphenyl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]hydrazinyl]-3-oxopropanoic acid (PubChem CID 139749194) has the molecular formula C37H37N5O6S and a molecular weight of 679.80 g/mol. Its IUPAC name is 3-[2-[(2S)-2-[[(2R)-2-[(3,5-dimethylbenzoyl)-methylamino]-3-(4-thiophen-3-ylphenyl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]hydrazinyl]-3-oxopropanoic acid.
| Compound Name | 3-[2-[(2S)-2-[[(2R)-2-[(3,5-dimethylbenzoyl)-methylamino]-3-(4-thiophen-3-ylphenyl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]hydrazinyl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 139749194 |
| Molecular Formula | C37H37N5O6S |
| Molecular Weight | 679.80 g/mol |
| Exact Mass | 679.25 |
| IUPAC Name | 3-[2-[(2S)-2-[[(2R)-2-[(3,5-dimethylbenzoyl)-methylamino]-3-(4-thiophen-3-ylphenyl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]hydrazinyl]-3-oxopropanoic acid |
| SMILES | Cc1cc(C)cc(C(=O)N(C)[C@H](Cc2ccc(-c3ccsc3)cc2)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)NNC(=O)CC(=O)O)c1 |
| InChI | InChI=1S/C37H37N5O6S/c1-22-14-23(2)16-27(15-22)37(48)42(3)32(17-24-8-10-25(11-9-24)26-12-13-49-21-26)36(47)39-31(35(46)41-40-33(43)19-34(44)45)18-28-20-38-30-7-5-4-6-29(28)30/h4-16,20-21,31-32,38H,17-19H2,1-3H3,(H,39,47)(H,40,43)(H,41,46)(H,44,45)/t31-,32+/m0/s1 |
| InChIKey | WVFPWNIOPVJZCF-AJQTZOPKSA-N |
| XLogP | 4.55 |
| TPSA | 160.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.80 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|