C13H9ClN4O2 — CID 139749208
13-amino-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaene-7,16-dione;hydrochloride (PubChem CID 139749208) has the molecular formula C13H9ClN4O2 and a molecular weight of 288.69 g/mol. Its IUPAC name is 13-amino-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaene-7,16-dione;hydrochloride.
| Compound Name | 13-amino-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaene-7,16-dione;hydrochloride |
|---|---|
| PubChem CID | 139749208 |
| Molecular Formula | C13H9ClN4O2 |
| Molecular Weight | 288.69 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 13-amino-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaene-7,16-dione;hydrochloride |
| SMILES | Cl.Nc1ccc2c(c1)C(=O)c1c-2[nH]c(=O)c2nccn12 |
| InChI | InChI=1S/C13H8N4O2.ClH/c14-6-1-2-7-8(5-6)11(18)10-9(7)16-13(19)12-15-3-4-17(10)12;/h1-5H,14H2,(H,16,19);1H |
| InChIKey | OAXWVASKSSQHLK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.69 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|