C20H26ClNO7 — CID 139749807
(3R)-6-(4-chlorophenyl)-3-(1,3-diacetyloxypropan-2-ylcarbamoyl)hexanoic acid (PubChem CID 139749807) has the molecular formula C20H26ClNO7 and a molecular weight of 427.88 g/mol. Its IUPAC name is (3R)-6-(4-chlorophenyl)-3-(1,3-diacetyloxypropan-2-ylcarbamoyl)hexanoic acid.
| Compound Name | (3R)-6-(4-chlorophenyl)-3-(1,3-diacetyloxypropan-2-ylcarbamoyl)hexanoic acid |
|---|---|
| PubChem CID | 139749807 |
| Molecular Formula | C20H26ClNO7 |
| Molecular Weight | 427.88 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | (3R)-6-(4-chlorophenyl)-3-(1,3-diacetyloxypropan-2-ylcarbamoyl)hexanoic acid |
| SMILES | CC(=O)OCC(COC(C)=O)NC(=O)[C@H](CCCc1ccc(Cl)cc1)CC(=O)O |
| InChI | InChI=1S/C20H26ClNO7/c1-13(23)28-11-18(12-29-14(2)24)22-20(27)16(10-19(25)26)5-3-4-15-6-8-17(21)9-7-15/h6-9,16,18H,3-5,10-12H2,1-2H3,(H,22,27)(H,25,26)/t16-/m1/s1 |
| InChIKey | ZGAXFIBQQKSHPM-MRXNPFEDSA-N |
| XLogP | 2.36 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.88 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |