About 1-[4-(2-chlorophenyl)-2-(dimethylamino)-1,3-thiazol-5-yl]-3-(2,6-difluorophenyl)urea
1-[4-(2-chlorophenyl)-2-(dimethylamino)-1,3-thiazol-5-yl]-3-(2,6-difluorophenyl)urea (PubChem CID 139750364) has the molecular formula C18H15ClF2N4OS
and a molecular weight of 408.86 g/mol. Its IUPAC name is 1-[4-(2-chlorophenyl)-2-(dimethylamino)-1,3-thiazol-5-yl]-3-(2,6-difluorophenyl)urea.
Molecular Properties
| Compound Name | 1-[4-(2-chlorophenyl)-2-(dimethylamino)-1,3-thiazol-5-yl]-3-(2,6-difluorophenyl)urea |
| PubChem CID | 139750364 |
| Molecular Formula | C18H15ClF2N4OS |
| Molecular Weight | 408.86 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 1-[4-(2-chlorophenyl)-2-(dimethylamino)-1,3-thiazol-5-yl]-3-(2,6-difluorophenyl)urea |
| SMILES | CN(C)c1nc(-c2ccccc2Cl)c(NC(=O)Nc2c(F)cccc2F)s1 |
| InChI | InChI=1S/C18H15ClF2N4OS/c1-25(2)18-23-14(10-6-3-4-7-11(10)19)16(27-18)24-17(26)22-15-12(20)8-5-9-13(15)21/h3-9H,1-2H3,(H2,22,24,26) |
| InChIKey | JNGZIXXAFBUGTN-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.86 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-(2-chlorophenyl)-2-(dimethylamino)-1,3-thiazol-5-yl]-3-(2,6-difluorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2-chlorophenyl)-2-(dimethylamino)-1,3-thiazol-5-yl]-3-(2,6-difluorophenyl)urea?
The IUPAC name of 1-[4-(2-chlorophenyl)-2-(dimethylamino)-1,3-thiazol-5-yl]-3-(2,6-difluorophenyl)urea (CID 139750364) is 1-[4-(2-chlorophenyl)-2-(dimethylamino)-1,3-thiazol-5-yl]-3-(2,6-difluorophenyl)urea.
What is the SMILES notation for 1-[4-(2-chlorophenyl)-2-(dimethylamino)-1,3-thiazol-5-yl]-3-(2,6-difluorophenyl)urea?
The canonical SMILES for 1-[4-(2-chlorophenyl)-2-(dimethylamino)-1,3-thiazol-5-yl]-3-(2,6-difluorophenyl)urea is CN(C)c1nc(-c2ccccc2Cl)c(NC(=O)Nc2c(F)cccc2F)s1.
What is the InChIKey of 1-[4-(2-chlorophenyl)-2-(dimethylamino)-1,3-thiazol-5-yl]-3-(2,6-difluorophenyl)urea?
The InChIKey is JNGZIXXAFBUGTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15ClF2N4OS/c1-25(2)18-23-14(10-6-3-4-7-11(10)19)16(27-18)24-17(26)22-15-12(20)8-5-9-13(15)21/h3-9H,1-2H3,(H2,22,24,26).
What are the key properties of 1-[4-(2-chlorophenyl)-2-(dimethylamino)-1,3-thiazol-5-yl]-3-(2,6-difluorophenyl)urea?
1-[4-(2-chlorophenyl)-2-(dimethylamino)-1,3-thiazol-5-yl]-3-(2,6-difluorophenyl)urea has a molecular weight of 408.86 g/mol, XLogP of 5.45, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2-chlorophenyl)-2-(dimethylamino)-1,3-thiazol-5-yl]-3-(2,6-difluorophenyl)urea is sourced from PubChem (CID 139750364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).