C24H21Cl2F3O4 — CID 139750782
1-(3,3-dichloroprop-2-enoxy)-5-[4-[4-(trifluoromethoxy)phenoxy]butoxy]naphthalene (PubChem CID 139750782) has the molecular formula C24H21Cl2F3O4 and a molecular weight of 501.33 g/mol. Its IUPAC name is 1-(3,3-dichloroprop-2-enoxy)-5-[4-[4-(trifluoromethoxy)phenoxy]butoxy]naphthalene.
| Compound Name | 1-(3,3-dichloroprop-2-enoxy)-5-[4-[4-(trifluoromethoxy)phenoxy]butoxy]naphthalene |
|---|---|
| PubChem CID | 139750782 |
| Molecular Formula | C24H21Cl2F3O4 |
| Molecular Weight | 501.33 g/mol |
| Exact Mass | 500.08 |
| IUPAC Name | 1-(3,3-dichloroprop-2-enoxy)-5-[4-[4-(trifluoromethoxy)phenoxy]butoxy]naphthalene |
| SMILES | FC(F)(F)Oc1ccc(OCCCCOc2cccc3c(OCC=C(Cl)Cl)cccc23)cc1 |
| InChI | InChI=1S/C24H21Cl2F3O4/c25-23(26)13-16-32-22-8-4-5-19-20(22)6-3-7-21(19)31-15-2-1-14-30-17-9-11-18(12-10-17)33-24(27,28)29/h3-13H,1-2,14-16H2 |
| InChIKey | BPNCLDPXZNARDY-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.33 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|