About 1-(3,3-dichloroprop-2-enoxy)-5-[4-[4-(trifluoromethoxy)phenoxy]butoxy]naphthalene
1-(3,3-dichloroprop-2-enoxy)-5-[4-[4-(trifluoromethoxy)phenoxy]butoxy]naphthalene (PubChem CID 139750782) has the molecular formula C24H21Cl2F3O4
and a molecular weight of 501.33 g/mol. Its IUPAC name is 1-(3,3-dichloroprop-2-enoxy)-5-[4-[4-(trifluoromethoxy)phenoxy]butoxy]naphthalene.
Molecular Properties
| Compound Name | 1-(3,3-dichloroprop-2-enoxy)-5-[4-[4-(trifluoromethoxy)phenoxy]butoxy]naphthalene |
| PubChem CID | 139750782 |
| Molecular Formula | C24H21Cl2F3O4 |
| Molecular Weight | 501.33 g/mol |
| Exact Mass | 500.08 |
| IUPAC Name | 1-(3,3-dichloroprop-2-enoxy)-5-[4-[4-(trifluoromethoxy)phenoxy]butoxy]naphthalene |
| SMILES | FC(F)(F)Oc1ccc(OCCCCOc2cccc3c(OCC=C(Cl)Cl)cccc23)cc1 |
| InChI | InChI=1S/C24H21Cl2F3O4/c25-23(26)13-16-32-22-8-4-5-19-20(22)6-3-7-21(19)31-15-2-1-14-30-17-9-11-18(12-10-17)33-24(27,28)29/h3-13H,1-2,14-16H2 |
| InChIKey | BPNCLDPXZNARDY-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 501.33 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-dichloroprop-2-enoxy)-5-[4-[4-(trifluoromethoxy)phenoxy]butoxy]naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-dichloroprop-2-enoxy)-5-[4-[4-(trifluoromethoxy)phenoxy]butoxy]naphthalene?
The IUPAC name of 1-(3,3-dichloroprop-2-enoxy)-5-[4-[4-(trifluoromethoxy)phenoxy]butoxy]naphthalene (CID 139750782) is 1-(3,3-dichloroprop-2-enoxy)-5-[4-[4-(trifluoromethoxy)phenoxy]butoxy]naphthalene.
What is the SMILES notation for 1-(3,3-dichloroprop-2-enoxy)-5-[4-[4-(trifluoromethoxy)phenoxy]butoxy]naphthalene?
The canonical SMILES for 1-(3,3-dichloroprop-2-enoxy)-5-[4-[4-(trifluoromethoxy)phenoxy]butoxy]naphthalene is FC(F)(F)Oc1ccc(OCCCCOc2cccc3c(OCC=C(Cl)Cl)cccc23)cc1.
What is the InChIKey of 1-(3,3-dichloroprop-2-enoxy)-5-[4-[4-(trifluoromethoxy)phenoxy]butoxy]naphthalene?
The InChIKey is BPNCLDPXZNARDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21Cl2F3O4/c25-23(26)13-16-32-22-8-4-5-19-20(22)6-3-7-21(19)31-15-2-1-14-30-17-9-11-18(12-10-17)33-24(27,28)29/h3-13H,1-2,14-16H2.
What are the key properties of 1-(3,3-dichloroprop-2-enoxy)-5-[4-[4-(trifluoromethoxy)phenoxy]butoxy]naphthalene?
1-(3,3-dichloroprop-2-enoxy)-5-[4-[4-(trifluoromethoxy)phenoxy]butoxy]naphthalene has a molecular weight of 501.33 g/mol, XLogP of 7.67, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dichloroprop-2-enoxy)-5-[4-[4-(trifluoromethoxy)phenoxy]butoxy]naphthalene is sourced from PubChem (CID 139750782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).