C13H19F6O3PS — CID 139752693
bis(2-hydroxyethyl)-[2-(4-methylphenyl)-2-oxoethyl]sulfanium hexafluorophosphate (PubChem CID 139752693) has the molecular formula C13H19F6O3PS and a molecular weight of 400.32 g/mol. Its IUPAC name is bis(2-hydroxyethyl)-[2-(4-methylphenyl)-2-oxoethyl]sulfanium hexafluorophosphate.
| Compound Name | bis(2-hydroxyethyl)-[2-(4-methylphenyl)-2-oxoethyl]sulfanium hexafluorophosphate |
|---|---|
| PubChem CID | 139752693 |
| Molecular Formula | C13H19F6O3PS |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | bis(2-hydroxyethyl)-[2-(4-methylphenyl)-2-oxoethyl]sulfanium hexafluorophosphate |
| SMILES | Cc1ccc(C(=O)C[S+](CCO)CCO)cc1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C13H19O3S.F6P/c1-11-2-4-12(5-3-11)13(16)10-17(8-6-14)9-7-15;1-7(2,3,4,5)6/h2-5,14-15H,6-10H2,1H3;/q+1;-1 |
| InChIKey | RFVUCPVNEGJUCX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|