About 5-butylpyridin-2-amine;hydrochloride
5-butylpyridin-2-amine;hydrochloride (PubChem CID 139753149) has the molecular formula C9H15ClN2
and a molecular weight of 186.69 g/mol. Its IUPAC name is 5-butylpyridin-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-butylpyridin-2-amine;hydrochloride |
| PubChem CID | 139753149 |
| Molecular Formula | C9H15ClN2 |
| Molecular Weight | 186.69 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 5-butylpyridin-2-amine;hydrochloride |
| SMILES | CCCCc1ccc(N)nc1.Cl |
| InChI | InChI=1S/C9H14N2.ClH/c1-2-3-4-8-5-6-9(10)11-7-8;/h5-7H,2-4H2,1H3,(H2,10,11);1H |
| InChIKey | ZDHHFEBVBKFIBM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.69 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-butylpyridin-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butylpyridin-2-amine;hydrochloride?
The IUPAC name of 5-butylpyridin-2-amine;hydrochloride (CID 139753149) is 5-butylpyridin-2-amine;hydrochloride.
What is the SMILES notation for 5-butylpyridin-2-amine;hydrochloride?
The canonical SMILES for 5-butylpyridin-2-amine;hydrochloride is CCCCc1ccc(N)nc1.Cl.
What is the InChIKey of 5-butylpyridin-2-amine;hydrochloride?
The InChIKey is ZDHHFEBVBKFIBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2.ClH/c1-2-3-4-8-5-6-9(10)11-7-8;/h5-7H,2-4H2,1H3,(H2,10,11);1H.
What are the key properties of 5-butylpyridin-2-amine;hydrochloride?
5-butylpyridin-2-amine;hydrochloride has a molecular weight of 186.69 g/mol, XLogP of 2.43, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butylpyridin-2-amine;hydrochloride is sourced from PubChem (CID 139753149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).