C16H18N4O3 — CID 139753997
[(E)-[(2,2-dimethyl-3,4-dihydrochromen-7-yl)-(1,2,4-triazol-1-yl)methylidene]amino] acetate (PubChem CID 139753997) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is [(E)-[(2,2-dimethyl-3,4-dihydrochromen-7-yl)-(1,2,4-triazol-1-yl)methylidene]amino] acetate.
| Compound Name | [(E)-[(2,2-dimethyl-3,4-dihydrochromen-7-yl)-(1,2,4-triazol-1-yl)methylidene]amino] acetate |
|---|---|
| PubChem CID | 139753997 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | [(E)-[(2,2-dimethyl-3,4-dihydrochromen-7-yl)-(1,2,4-triazol-1-yl)methylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(\c1ccc2c(c1)OC(C)(C)CC2)n1cncn1 |
| InChI | InChI=1S/C16H18N4O3/c1-11(21)23-19-15(20-10-17-9-18-20)13-5-4-12-6-7-16(2,3)22-14(12)8-13/h4-5,8-10H,6-7H2,1-3H3/b19-15+ |
| InChIKey | CCTQGFXCOKKDOH-XDJHFCHBSA-N |
| XLogP | 2.15 |
| TPSA | 78.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|