C8H10ClNOS — CID 139754280
2-methyl-4-propan-2-yl-1,3-thiazole-5-carbonyl chloride (PubChem CID 139754280) has the molecular formula C8H10ClNOS and a molecular weight of 203.69 g/mol. Its IUPAC name is 2-methyl-4-propan-2-yl-1,3-thiazole-5-carbonyl chloride.
| Compound Name | 2-methyl-4-propan-2-yl-1,3-thiazole-5-carbonyl chloride |
|---|---|
| PubChem CID | 139754280 |
| Molecular Formula | C8H10ClNOS |
| Molecular Weight | 203.69 g/mol |
| Exact Mass | 203.02 |
| IUPAC Name | 2-methyl-4-propan-2-yl-1,3-thiazole-5-carbonyl chloride |
| SMILES | Cc1nc(C(C)C)c(C(=O)Cl)s1 |
| InChI | InChI=1S/C8H10ClNOS/c1-4(2)6-7(8(9)11)12-5(3)10-6/h4H,1-3H3 |
| InChIKey | KYHHEDQTGQJHIQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.69 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|