C25H35IO3 — CID 139755291
ethyl (E)-3-[(2R,4aR,5S,6S,8R,8aS)-6-hydroxy-5-[(4-iodophenyl)methyl]-8,8a-dimethyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-2-yl]but-2-enoate (PubChem CID 139755291) has the molecular formula C25H35IO3 and a molecular weight of 510.46 g/mol. Its IUPAC name is ethyl (E)-3-[(2R,4aR,5S,6S,8R,8aS)-6-hydroxy-5-[(4-iodophenyl)methyl]-8,8a-dimethyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-2-yl]but-2-enoate.
| Compound Name | ethyl (E)-3-[(2R,4aR,5S,6S,8R,8aS)-6-hydroxy-5-[(4-iodophenyl)methyl]-8,8a-dimethyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-2-yl]but-2-enoate |
|---|---|
| PubChem CID | 139755291 |
| Molecular Formula | C25H35IO3 |
| Molecular Weight | 510.46 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | ethyl (E)-3-[(2R,4aR,5S,6S,8R,8aS)-6-hydroxy-5-[(4-iodophenyl)methyl]-8,8a-dimethyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-2-yl]but-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)[C@@H]1CC[C@@H]2[C@H](Cc3ccc(I)cc3)[C@@H](O)C[C@@H](C)[C@]2(C)C1 |
| InChI | InChI=1S/C25H35IO3/c1-5-29-24(28)12-16(2)19-8-11-22-21(14-18-6-9-20(26)10-7-18)23(27)13-17(3)25(22,4)15-19/h6-7,9-10,12,17,19,21-23,27H,5,8,11,13-15H2,1-4H3/b16-12+/t17-,19-,21+,22-,23+,25+/m1/s1 |
| InChIKey | JUSAYXWAPTWXGX-OEAOUAETSA-N |
| XLogP | 5.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.46 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|