C17H22O3 — CID 139755708
2-(2-hydroxyethyl)-9,9-dimethyl-5,6,10,11-tetradehydro-3,4,7,8-tetrahydro-2H-cyclopenta[10]annulene-3a,7-diol (PubChem CID 139755708) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-9,9-dimethyl-5,6,10,11-tetradehydro-3,4,7,8-tetrahydro-2H-cyclopenta[10]annulene-3a,7-diol.
| Compound Name | 2-(2-hydroxyethyl)-9,9-dimethyl-5,6,10,11-tetradehydro-3,4,7,8-tetrahydro-2H-cyclopenta[10]annulene-3a,7-diol |
|---|---|
| PubChem CID | 139755708 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 2-(2-hydroxyethyl)-9,9-dimethyl-5,6,10,11-tetradehydro-3,4,7,8-tetrahydro-2H-cyclopenta[10]annulene-3a,7-diol |
| SMILES | CC1(C)C#CC2=CC(CCO)CC2(O)CC#CC(O)C1 |
| InChI | InChI=1S/C17H22O3/c1-16(2)8-5-14-10-13(6-9-18)11-17(14,20)7-3-4-15(19)12-16/h10,13,15,18-20H,6-7,9,11-12H2,1-2H3 |
| InChIKey | RRRZUOHCVRNREP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|