C41H77BrO3Si2Sn — CID 139755709
2-bromo-1-(6,6-dimethyl-8-tributylstannyl-4-triethylsilyloxyocta-2,7-diynyl)-4-(2-triethylsilyloxyethyl)cyclopent-2-en-1-ol (PubChem CID 139755709) has the molecular formula C41H77BrO3Si2Sn and a molecular weight of 872.85 g/mol. Its IUPAC name is 2-bromo-1-(6,6-dimethyl-8-tributylstannyl-4-triethylsilyloxyocta-2,7-diynyl)-4-(2-triethylsilyloxyethyl)cyclopent-2-en-1-ol.
| Compound Name | 2-bromo-1-(6,6-dimethyl-8-tributylstannyl-4-triethylsilyloxyocta-2,7-diynyl)-4-(2-triethylsilyloxyethyl)cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 139755709 |
| Molecular Formula | C41H77BrO3Si2Sn |
| Molecular Weight | 872.85 g/mol |
| Exact Mass | 872.36 |
| IUPAC Name | 2-bromo-1-(6,6-dimethyl-8-tributylstannyl-4-triethylsilyloxyocta-2,7-diynyl)-4-(2-triethylsilyloxyethyl)cyclopent-2-en-1-ol |
| SMILES | CCCC[Sn](C#CC(C)(C)CC(C#CCC1(O)CC(CCO[Si](CC)(CC)CC)C=C1Br)O[Si](CC)(CC)CC)(CCCC)CCCC |
| InChI | InChI=1S/C29H50BrO3Si2.3C4H9.Sn/c1-10-28(8,9)24-26(33-35(14-5,15-6)16-7)18-17-20-29(31)23-25(22-27(29)30)19-21-32-34(11-2,12-3)13-4;3*1-3-4-2;/h22,25-26,31H,11-16,19-21,23-24H2,2-9H3;3*1,3-4H2,2H3; |
| InChIKey | DIGRJIRVGBIIDN-UHFFFAOYSA-N |
| XLogP | 13.02 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.85 |
| LogP ≤ 5 | 13.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|