C23H12F6N2O6 — CID 139756126
1-[4-[2-[4-(2,5-dioxopyrrol-1-yl)-3-hydroxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]pyrrole-2,5-dione (PubChem CID 139756126) has the molecular formula C23H12F6N2O6 and a molecular weight of 526.35 g/mol. Its IUPAC name is 1-[4-[2-[4-(2,5-dioxopyrrol-1-yl)-3-hydroxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-[2-[4-(2,5-dioxopyrrol-1-yl)-3-hydroxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 139756126 |
| Molecular Formula | C23H12F6N2O6 |
| Molecular Weight | 526.35 g/mol |
| Exact Mass | 526.06 |
| IUPAC Name | 1-[4-[2-[4-(2,5-dioxopyrrol-1-yl)-3-hydroxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1c1ccc(C(c2ccc(N3C(=O)C=CC3=O)c(O)c2)(C(F)(F)F)C(F)(F)F)cc1O |
| InChI | InChI=1S/C23H12F6N2O6/c24-22(25,26)21(23(27,28)29,11-1-3-13(15(32)9-11)30-17(34)5-6-18(30)35)12-2-4-14(16(33)10-12)31-19(36)7-8-20(31)37/h1-10,32-33H |
| InChIKey | CZYYSEKLWYHARV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|