About 3-hydroxypropyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate
3-hydroxypropyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate (PubChem CID 139756221) has the molecular formula C12H16O4
and a molecular weight of 224.26 g/mol. Its IUPAC name is 3-hydroxypropyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate.
Molecular Properties
| Compound Name | 3-hydroxypropyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate |
| PubChem CID | 139756221 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 3-hydroxypropyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate |
| SMILES | C=C(C(=O)OCCCO)C1(O)C=CC=CC1 |
| InChI | InChI=1S/C12H16O4/c1-10(11(14)16-9-5-8-13)12(15)6-3-2-4-7-12/h2-4,6,13,15H,1,5,7-9H2 |
| InChIKey | IHLPZDXFPLLWBG-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxypropyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxypropyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate?
The IUPAC name of 3-hydroxypropyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate (CID 139756221) is 3-hydroxypropyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate.
What is the SMILES notation for 3-hydroxypropyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate?
The canonical SMILES for 3-hydroxypropyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate is C=C(C(=O)OCCCO)C1(O)C=CC=CC1.
What is the InChIKey of 3-hydroxypropyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate?
The InChIKey is IHLPZDXFPLLWBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O4/c1-10(11(14)16-9-5-8-13)12(15)6-3-2-4-7-12/h2-4,6,13,15H,1,5,7-9H2.
What are the key properties of 3-hydroxypropyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate?
3-hydroxypropyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate has a molecular weight of 224.26 g/mol, XLogP of 0.72, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxypropyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate is sourced from PubChem (CID 139756221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).