About 4-hydroxybutyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate
4-hydroxybutyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate (PubChem CID 139756242) has the molecular formula C13H18O4
and a molecular weight of 238.28 g/mol. Its IUPAC name is 4-hydroxybutyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate.
Molecular Properties
| Compound Name | 4-hydroxybutyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate |
| PubChem CID | 139756242 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 4-hydroxybutyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate |
| SMILES | C=C(C(=O)OCCCCO)C1(O)C=CC=CC1 |
| InChI | InChI=1S/C13H18O4/c1-11(12(15)17-10-6-5-9-14)13(16)7-3-2-4-8-13/h2-4,7,14,16H,1,5-6,8-10H2 |
| InChIKey | XQPUTYTZHUVINM-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxybutyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxybutyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate?
The IUPAC name of 4-hydroxybutyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate (CID 139756242) is 4-hydroxybutyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate.
What is the SMILES notation for 4-hydroxybutyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate?
The canonical SMILES for 4-hydroxybutyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate is C=C(C(=O)OCCCCO)C1(O)C=CC=CC1.
What is the InChIKey of 4-hydroxybutyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate?
The InChIKey is XQPUTYTZHUVINM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O4/c1-11(12(15)17-10-6-5-9-14)13(16)7-3-2-4-8-13/h2-4,7,14,16H,1,5-6,8-10H2.
What are the key properties of 4-hydroxybutyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate?
4-hydroxybutyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate has a molecular weight of 238.28 g/mol, XLogP of 1.11, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybutyl 2-(1-hydroxycyclohexa-2,4-dien-1-yl)prop-2-enoate is sourced from PubChem (CID 139756242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).