C14H20F3NO3S — CID 139756459
2,3,5-trimethyl-1-oxido-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]pyridin-1-ium (PubChem CID 139756459) has the molecular formula C14H20F3NO3S and a molecular weight of 339.38 g/mol. Its IUPAC name is 2,3,5-trimethyl-1-oxido-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]pyridin-1-ium.
| Compound Name | 2,3,5-trimethyl-1-oxido-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]pyridin-1-ium |
|---|---|
| PubChem CID | 139756459 |
| Molecular Formula | C14H20F3NO3S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 2,3,5-trimethyl-1-oxido-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]pyridin-1-ium |
| SMILES | Cc1c[n+]([O-])c(C)c(C)c1SCCOCCOCC(F)(F)F |
| InChI | InChI=1S/C14H20F3NO3S/c1-10-8-18(19)12(3)11(2)13(10)22-7-6-20-4-5-21-9-14(15,16)17/h8H,4-7,9H2,1-3H3 |
| InChIKey | ASDDWFAXLOUROQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|