C15H16F4O4 — CID 139757381
5-ethoxy-4-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]oxolan-2-one (PubChem CID 139757381) has the molecular formula C15H16F4O4 and a molecular weight of 336.28 g/mol. Its IUPAC name is 5-ethoxy-4-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]oxolan-2-one.
| Compound Name | 5-ethoxy-4-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]oxolan-2-one |
|---|---|
| PubChem CID | 139757381 |
| Molecular Formula | C15H16F4O4 |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 5-ethoxy-4-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]oxolan-2-one |
| SMILES | CCOC1OC(=O)CC1c1ccc(OCC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C15H16F4O4/c1-2-21-13-11(7-12(20)23-13)9-3-5-10(6-4-9)22-8-15(18,19)14(16)17/h3-6,11,13-14H,2,7-8H2,1H3 |
| InChIKey | DZXYRNRZFTUYHH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|