C20H21N3O4S2 — CID 139757515
(6R)-8-oxo-7-[(2-phenoxyacetyl)amino]-3-(pyrrolidin-3-ylidenemethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid (PubChem CID 139757515) has the molecular formula C20H21N3O4S2 and a molecular weight of 431.54 g/mol. Its IUPAC name is (6R)-8-oxo-7-[(2-phenoxyacetyl)amino]-3-(pyrrolidin-3-ylidenemethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid.
| Compound Name | (6R)-8-oxo-7-[(2-phenoxyacetyl)amino]-3-(pyrrolidin-3-ylidenemethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid |
|---|---|
| PubChem CID | 139757515 |
| Molecular Formula | C20H21N3O4S2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | (6R)-8-oxo-7-[(2-phenoxyacetyl)amino]-3-(pyrrolidin-3-ylidenemethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioic S-acid |
| SMILES | O=C(COc1ccccc1)NC1C(=O)N2C(C(=O)S)=C(C=C3CCNC3)CS[C@H]12 |
| InChI | InChI=1S/C20H21N3O4S2/c24-15(10-27-14-4-2-1-3-5-14)22-16-18(25)23-17(20(26)28)13(11-29-19(16)23)8-12-6-7-21-9-12/h1-5,8,16,19,21H,6-7,9-11H2,(H,22,24)(H,26,28)/t16?,19-/m1/s1 |
| InChIKey | CDBPJKVWBYFFJB-LRTDYKAYSA-N |
| XLogP | 1.10 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|