About 1,7-bis(2-hydroxyethylimino)-2,6-dimethylheptan-4-one
1,7-bis(2-hydroxyethylimino)-2,6-dimethylheptan-4-one (PubChem CID 139757721) has the molecular formula C13H24N2O3
and a molecular weight of 256.35 g/mol. Its IUPAC name is 1,7-bis(2-hydroxyethylimino)-2,6-dimethylheptan-4-one.
Molecular Properties
| Compound Name | 1,7-bis(2-hydroxyethylimino)-2,6-dimethylheptan-4-one |
| PubChem CID | 139757721 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 1,7-bis(2-hydroxyethylimino)-2,6-dimethylheptan-4-one |
| SMILES | CC(/C=N/CCO)CC(=O)CC(C)/C=N/CCO |
| InChI | InChI=1S/C13H24N2O3/c1-11(9-14-3-5-16)7-13(18)8-12(2)10-15-4-6-17/h9-12,16-17H,3-8H2,1-2H3/b14-9+,15-10+ |
| InChIKey | NMWAYCRYWLOAGX-AOEKMSOUSA-N |
| XLogP | 0.73 |
| TPSA | 82.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1,7-bis(2-hydroxyethylimino)-2,6-dimethylheptan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-bis(2-hydroxyethylimino)-2,6-dimethylheptan-4-one?
The IUPAC name of 1,7-bis(2-hydroxyethylimino)-2,6-dimethylheptan-4-one (CID 139757721) is 1,7-bis(2-hydroxyethylimino)-2,6-dimethylheptan-4-one.
What is the SMILES notation for 1,7-bis(2-hydroxyethylimino)-2,6-dimethylheptan-4-one?
The canonical SMILES for 1,7-bis(2-hydroxyethylimino)-2,6-dimethylheptan-4-one is CC(/C=N/CCO)CC(=O)CC(C)/C=N/CCO.
What is the InChIKey of 1,7-bis(2-hydroxyethylimino)-2,6-dimethylheptan-4-one?
The InChIKey is NMWAYCRYWLOAGX-AOEKMSOUSA-N. The full InChI is InChI=1S/C13H24N2O3/c1-11(9-14-3-5-16)7-13(18)8-12(2)10-15-4-6-17/h9-12,16-17H,3-8H2,1-2H3/b14-9+,15-10+.
What are the key properties of 1,7-bis(2-hydroxyethylimino)-2,6-dimethylheptan-4-one?
1,7-bis(2-hydroxyethylimino)-2,6-dimethylheptan-4-one has a molecular weight of 256.35 g/mol, XLogP of 0.73, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-bis(2-hydroxyethylimino)-2,6-dimethylheptan-4-one is sourced from PubChem (CID 139757721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).