About 4,5-dichloro-3-hydroxy-6-(4-methylpentan-2-yloxy)benzene-1,2-dicarbonitrile
4,5-dichloro-3-hydroxy-6-(4-methylpentan-2-yloxy)benzene-1,2-dicarbonitrile (PubChem CID 139757766) has the molecular formula C14H14Cl2N2O2
and a molecular weight of 313.18 g/mol. Its IUPAC name is 4,5-dichloro-3-hydroxy-6-(4-methylpentan-2-yloxy)benzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4,5-dichloro-3-hydroxy-6-(4-methylpentan-2-yloxy)benzene-1,2-dicarbonitrile |
| PubChem CID | 139757766 |
| Molecular Formula | C14H14Cl2N2O2 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 4,5-dichloro-3-hydroxy-6-(4-methylpentan-2-yloxy)benzene-1,2-dicarbonitrile |
| SMILES | CC(C)CC(C)Oc1c(Cl)c(Cl)c(O)c(C#N)c1C#N |
| InChI | InChI=1S/C14H14Cl2N2O2/c1-7(2)4-8(3)20-14-10(6-18)9(5-17)13(19)11(15)12(14)16/h7-8,19H,4H2,1-3H3 |
| InChIKey | SIOBMAGMUKTKNF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-dichloro-3-hydroxy-6-(4-methylpentan-2-yloxy)benzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-3-hydroxy-6-(4-methylpentan-2-yloxy)benzene-1,2-dicarbonitrile?
The IUPAC name of 4,5-dichloro-3-hydroxy-6-(4-methylpentan-2-yloxy)benzene-1,2-dicarbonitrile (CID 139757766) is 4,5-dichloro-3-hydroxy-6-(4-methylpentan-2-yloxy)benzene-1,2-dicarbonitrile.
What is the SMILES notation for 4,5-dichloro-3-hydroxy-6-(4-methylpentan-2-yloxy)benzene-1,2-dicarbonitrile?
The canonical SMILES for 4,5-dichloro-3-hydroxy-6-(4-methylpentan-2-yloxy)benzene-1,2-dicarbonitrile is CC(C)CC(C)Oc1c(Cl)c(Cl)c(O)c(C#N)c1C#N.
What is the InChIKey of 4,5-dichloro-3-hydroxy-6-(4-methylpentan-2-yloxy)benzene-1,2-dicarbonitrile?
The InChIKey is SIOBMAGMUKTKNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14Cl2N2O2/c1-7(2)4-8(3)20-14-10(6-18)9(5-17)13(19)11(15)12(14)16/h7-8,19H,4H2,1-3H3.
What are the key properties of 4,5-dichloro-3-hydroxy-6-(4-methylpentan-2-yloxy)benzene-1,2-dicarbonitrile?
4,5-dichloro-3-hydroxy-6-(4-methylpentan-2-yloxy)benzene-1,2-dicarbonitrile has a molecular weight of 313.18 g/mol, XLogP of 4.26, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-3-hydroxy-6-(4-methylpentan-2-yloxy)benzene-1,2-dicarbonitrile is sourced from PubChem (CID 139757766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).