C10H9FN4O3 — CID 139757934
(3S,4R,5S)-2-(fluoromethylidene)-5-(7H-purin-2-yl)oxolane-3,4-diol (PubChem CID 139757934) has the molecular formula C10H9FN4O3 and a molecular weight of 252.21 g/mol. Its IUPAC name is (3S,4R,5S)-2-(fluoromethylidene)-5-(7H-purin-2-yl)oxolane-3,4-diol.
| Compound Name | (3S,4R,5S)-2-(fluoromethylidene)-5-(7H-purin-2-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 139757934 |
| Molecular Formula | C10H9FN4O3 |
| Molecular Weight | 252.21 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | (3S,4R,5S)-2-(fluoromethylidene)-5-(7H-purin-2-yl)oxolane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)C(=CF)O[C@H]1c1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C10H9FN4O3/c11-1-5-6(16)7(17)8(18-5)10-12-2-4-9(15-10)14-3-13-4/h1-3,6-8,16-17H,(H,12,13,14,15)/t6-,7-,8-/m1/s1 |
| InChIKey | NGYRXRQYKMYCTB-BWZBUEFSSA-N |
| XLogP | -0.04 |
| TPSA | 104.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.21 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |