C14H15ClFN3O2S — CID 139758249
6-(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)-2,4-dimethyl-3-sulfanylidene-1,2,4-triazin-5-one (PubChem CID 139758249) has the molecular formula C14H15ClFN3O2S and a molecular weight of 343.81 g/mol. Its IUPAC name is 6-(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)-2,4-dimethyl-3-sulfanylidene-1,2,4-triazin-5-one.
| Compound Name | 6-(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)-2,4-dimethyl-3-sulfanylidene-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 139758249 |
| Molecular Formula | C14H15ClFN3O2S |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 6-(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)-2,4-dimethyl-3-sulfanylidene-1,2,4-triazin-5-one |
| SMILES | CC(C)Oc1cc(-c2nn(C)c(=S)n(C)c2=O)c(F)cc1Cl |
| InChI | InChI=1S/C14H15ClFN3O2S/c1-7(2)21-11-5-8(10(16)6-9(11)15)12-13(20)18(3)14(22)19(4)17-12/h5-7H,1-4H3 |
| InChIKey | UXXVVSQPMZUTJZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|