C28H28ClFN4O4 — CID 139758753
1-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-4-methyl-3-(3-nitrophenyl)benzimidazol-2-one;hydrochloride (PubChem CID 139758753) has the molecular formula C28H28ClFN4O4 and a molecular weight of 539.01 g/mol. Its IUPAC name is 1-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-4-methyl-3-(3-nitrophenyl)benzimidazol-2-one;hydrochloride.
| Compound Name | 1-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-4-methyl-3-(3-nitrophenyl)benzimidazol-2-one;hydrochloride |
|---|---|
| PubChem CID | 139758753 |
| Molecular Formula | C28H28ClFN4O4 |
| Molecular Weight | 539.01 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | 1-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-4-methyl-3-(3-nitrophenyl)benzimidazol-2-one;hydrochloride |
| SMILES | Cc1cccc2c1n(-c1cccc([N+](=O)[O-])c1)c(=O)n2CCN1CCC(C(=O)c2ccc(F)cc2)CC1.Cl |
| InChI | InChI=1S/C28H27FN4O4.ClH/c1-19-4-2-7-25-26(19)32(23-5-3-6-24(18-23)33(36)37)28(35)31(25)17-16-30-14-12-21(13-15-30)27(34)20-8-10-22(29)11-9-20;/h2-11,18,21H,12-17H2,1H3;1H |
| InChIKey | NRFBQPPQSQGRED-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 90.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.01 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|