About O-ethenyl heptadecanethioate
O-ethenyl heptadecanethioate (PubChem CID 139759138) has the molecular formula C19H36OS
and a molecular weight of 312.56 g/mol. Its IUPAC name is O-ethenyl heptadecanethioate.
Molecular Properties
| Compound Name | O-ethenyl heptadecanethioate |
| PubChem CID | 139759138 |
| Molecular Formula | C19H36OS |
| Molecular Weight | 312.56 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | O-ethenyl heptadecanethioate |
| SMILES | C=COC(=S)CCCCCCCCCCCCCCCC |
| InChI | InChI=1S/C19H36OS/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(21)20-4-2/h4H,2-3,5-18H2,1H3 |
| InChIKey | AFZWZIXAFYFTIX-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.56 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-ethenyl heptadecanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-ethenyl heptadecanethioate?
The IUPAC name of O-ethenyl heptadecanethioate (CID 139759138) is O-ethenyl heptadecanethioate.
What is the SMILES notation for O-ethenyl heptadecanethioate?
The canonical SMILES for O-ethenyl heptadecanethioate is C=COC(=S)CCCCCCCCCCCCCCCC.
What is the InChIKey of O-ethenyl heptadecanethioate?
The InChIKey is AFZWZIXAFYFTIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36OS/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(21)20-4-2/h4H,2-3,5-18H2,1H3.
What are the key properties of O-ethenyl heptadecanethioate?
O-ethenyl heptadecanethioate has a molecular weight of 312.56 g/mol, XLogP of 7.35, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-ethenyl heptadecanethioate is sourced from PubChem (CID 139759138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).