C30H37N3O6S — CID 139759593
tert-butyl N-[2-[[2-[(4-methylphenyl)sulfonylamino]-3-(4-phenylmethoxyphenyl)propanoyl]amino]ethyl]carbamate (PubChem CID 139759593) has the molecular formula C30H37N3O6S and a molecular weight of 567.71 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-[(4-methylphenyl)sulfonylamino]-3-(4-phenylmethoxyphenyl)propanoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-[(4-methylphenyl)sulfonylamino]-3-(4-phenylmethoxyphenyl)propanoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 139759593 |
| Molecular Formula | C30H37N3O6S |
| Molecular Weight | 567.71 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | tert-butyl N-[2-[[2-[(4-methylphenyl)sulfonylamino]-3-(4-phenylmethoxyphenyl)propanoyl]amino]ethyl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)NC(Cc2ccc(OCc3ccccc3)cc2)C(=O)NCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C30H37N3O6S/c1-22-10-16-26(17-11-22)40(36,37)33-27(28(34)31-18-19-32-29(35)39-30(2,3)4)20-23-12-14-25(15-13-23)38-21-24-8-6-5-7-9-24/h5-17,27,33H,18-21H2,1-4H3,(H,31,34)(H,32,35) |
| InChIKey | PNBOTJSZDVGXAX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.71 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|