About 2,3-bis(2-methylphenyl)-1H-tetrazol-1-ium-5-carbonitrile;chloride;hydrate
2,3-bis(2-methylphenyl)-1H-tetrazol-1-ium-5-carbonitrile;chloride;hydrate (PubChem CID 139759777) has the molecular formula C16H18ClN5O
and a molecular weight of 331.81 g/mol. Its IUPAC name is 2,3-bis(2-methylphenyl)-1H-tetrazol-1-ium-5-carbonitrile;chloride;hydrate.
Molecular Properties
| Compound Name | 2,3-bis(2-methylphenyl)-1H-tetrazol-1-ium-5-carbonitrile;chloride;hydrate |
| PubChem CID | 139759777 |
| Molecular Formula | C16H18ClN5O |
| Molecular Weight | 331.81 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 2,3-bis(2-methylphenyl)-1H-tetrazol-1-ium-5-carbonitrile;chloride;hydrate |
| SMILES | Cc1ccccc1N1N=C(C#N)[NH2+]N1c1ccccc1C.O.[Cl-] |
| InChI | InChI=1S/C16H15N5.ClH.H2O/c1-12-7-3-5-9-14(12)20-18-16(11-17)19-21(20)15-10-6-4-8-13(15)2;;/h3-10H,1-2H3,(H,18,19);1H;1H2 |
| InChIKey | BISWDPOTGHSEQZ-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.81 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis(2-methylphenyl)-1H-tetrazol-1-ium-5-carbonitrile;chloride;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(2-methylphenyl)-1H-tetrazol-1-ium-5-carbonitrile;chloride;hydrate?
The IUPAC name of 2,3-bis(2-methylphenyl)-1H-tetrazol-1-ium-5-carbonitrile;chloride;hydrate (CID 139759777) is 2,3-bis(2-methylphenyl)-1H-tetrazol-1-ium-5-carbonitrile;chloride;hydrate.
What is the SMILES notation for 2,3-bis(2-methylphenyl)-1H-tetrazol-1-ium-5-carbonitrile;chloride;hydrate?
The canonical SMILES for 2,3-bis(2-methylphenyl)-1H-tetrazol-1-ium-5-carbonitrile;chloride;hydrate is Cc1ccccc1N1N=C(C#N)[NH2+]N1c1ccccc1C.O.[Cl-].
What is the InChIKey of 2,3-bis(2-methylphenyl)-1H-tetrazol-1-ium-5-carbonitrile;chloride;hydrate?
The InChIKey is BISWDPOTGHSEQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N5.ClH.H2O/c1-12-7-3-5-9-14(12)20-18-16(11-17)19-21(20)15-10-6-4-8-13(15)2;;/h3-10H,1-2H3,(H,18,19);1H;1H2.
What are the key properties of 2,3-bis(2-methylphenyl)-1H-tetrazol-1-ium-5-carbonitrile;chloride;hydrate?
2,3-bis(2-methylphenyl)-1H-tetrazol-1-ium-5-carbonitrile;chloride;hydrate has a molecular weight of 331.81 g/mol, XLogP of -1.96, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(2-methylphenyl)-1H-tetrazol-1-ium-5-carbonitrile;chloride;hydrate is sourced from PubChem (CID 139759777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).