About 1-methyl-1-aza-6-azanidacyclodecane;trichlorotitanium(1+)
1-methyl-1-aza-6-azanidacyclodecane;trichlorotitanium(1+) (PubChem CID 139760025) has the molecular formula C9H19Cl3N2Ti
and a molecular weight of 309.49 g/mol. Its IUPAC name is 1-methyl-1-aza-6-azanidacyclodecane;trichlorotitanium(1+).
Molecular Properties
| Compound Name | 1-methyl-1-aza-6-azanidacyclodecane;trichlorotitanium(1+) |
| PubChem CID | 139760025 |
| Molecular Formula | C9H19Cl3N2Ti |
| Molecular Weight | 309.49 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 1-methyl-1-aza-6-azanidacyclodecane;trichlorotitanium(1+) |
| SMILES | CN1CCCC[N-]CCCC1.Cl[Ti+](Cl)Cl |
| InChI | InChI=1S/C9H19N2.3ClH.Ti/c1-11-8-4-2-6-10-7-3-5-9-11;;;;/h2-9H2,1H3;3*1H;/q-1;;;;+4/p-3 |
| InChIKey | OZWFEXOKFCPILM-UHFFFAOYSA-K |
| XLogP | 3.93 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-1-aza-6-azanidacyclodecane;trichlorotitanium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1-aza-6-azanidacyclodecane;trichlorotitanium(1+)?
The IUPAC name of 1-methyl-1-aza-6-azanidacyclodecane;trichlorotitanium(1+) (CID 139760025) is 1-methyl-1-aza-6-azanidacyclodecane;trichlorotitanium(1+).
What is the SMILES notation for 1-methyl-1-aza-6-azanidacyclodecane;trichlorotitanium(1+)?
The canonical SMILES for 1-methyl-1-aza-6-azanidacyclodecane;trichlorotitanium(1+) is CN1CCCC[N-]CCCC1.Cl[Ti+](Cl)Cl.
What is the InChIKey of 1-methyl-1-aza-6-azanidacyclodecane;trichlorotitanium(1+)?
The InChIKey is OZWFEXOKFCPILM-UHFFFAOYSA-K. The full InChI is InChI=1S/C9H19N2.3ClH.Ti/c1-11-8-4-2-6-10-7-3-5-9-11;;;;/h2-9H2,1H3;3*1H;/q-1;;;;+4/p-3.
What are the key properties of 1-methyl-1-aza-6-azanidacyclodecane;trichlorotitanium(1+)?
1-methyl-1-aza-6-azanidacyclodecane;trichlorotitanium(1+) has a molecular weight of 309.49 g/mol, XLogP of 3.93, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1-aza-6-azanidacyclodecane;trichlorotitanium(1+) is sourced from PubChem (CID 139760025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).