C23H21NO2 — CID 139760133
(6aS,12bR)-2-phenyl-5,6,6a,7,8,12b-hexahydrobenzo[a]phenanthridine-10,11-diol (PubChem CID 139760133) has the molecular formula C23H21NO2 and a molecular weight of 343.43 g/mol. Its IUPAC name is (6aS,12bR)-2-phenyl-5,6,6a,7,8,12b-hexahydrobenzo[a]phenanthridine-10,11-diol.
| Compound Name | (6aS,12bR)-2-phenyl-5,6,6a,7,8,12b-hexahydrobenzo[a]phenanthridine-10,11-diol |
|---|---|
| PubChem CID | 139760133 |
| Molecular Formula | C23H21NO2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (6aS,12bR)-2-phenyl-5,6,6a,7,8,12b-hexahydrobenzo[a]phenanthridine-10,11-diol |
| SMILES | Oc1cc2c(cc1O)[C@@H]1c3cc(-c4ccccc4)ccc3CN[C@H]1CC2 |
| InChI | InChI=1S/C23H21NO2/c25-21-11-16-8-9-20-23(19(16)12-22(21)26)18-10-15(6-7-17(18)13-24-20)14-4-2-1-3-5-14/h1-7,10-12,20,23-26H,8-9,13H2/t20-,23-/m0/s1 |
| InChIKey | RMDMGQSKVJJQEX-REWPJTCUSA-N |
| XLogP | 4.31 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|