C18H18FNO2 — CID 139760150
(6aS,12bR)-2-fluoro-6-methyl-6a,7,8,12b-tetrahydro-5H-benzo[a]phenanthridine-10,11-diol (PubChem CID 139760150) has the molecular formula C18H18FNO2 and a molecular weight of 299.35 g/mol. Its IUPAC name is (6aS,12bR)-2-fluoro-6-methyl-6a,7,8,12b-tetrahydro-5H-benzo[a]phenanthridine-10,11-diol.
| Compound Name | (6aS,12bR)-2-fluoro-6-methyl-6a,7,8,12b-tetrahydro-5H-benzo[a]phenanthridine-10,11-diol |
|---|---|
| PubChem CID | 139760150 |
| Molecular Formula | C18H18FNO2 |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (6aS,12bR)-2-fluoro-6-methyl-6a,7,8,12b-tetrahydro-5H-benzo[a]phenanthridine-10,11-diol |
| SMILES | CN1Cc2ccc(F)cc2[C@H]2c3cc(O)c(O)cc3CC[C@@H]21 |
| InChI | InChI=1S/C18H18FNO2/c1-20-9-11-2-4-12(19)7-13(11)18-14-8-17(22)16(21)6-10(14)3-5-15(18)20/h2,4,6-8,15,18,21-22H,3,5,9H2,1H3/t15-,18-/m0/s1 |
| InChIKey | JNQFATIPRLSOFF-YJBOKZPZSA-N |
| XLogP | 3.13 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|