C12H16N2O7 — CID 139760229
4-hydroxy-1,2-bis(prop-2-enoxycarbonyl)pyrazolidine-3-carboxylic acid (PubChem CID 139760229) has the molecular formula C12H16N2O7 and a molecular weight of 300.27 g/mol. Its IUPAC name is 4-hydroxy-1,2-bis(prop-2-enoxycarbonyl)pyrazolidine-3-carboxylic acid.
| Compound Name | 4-hydroxy-1,2-bis(prop-2-enoxycarbonyl)pyrazolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 139760229 |
| Molecular Formula | C12H16N2O7 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 4-hydroxy-1,2-bis(prop-2-enoxycarbonyl)pyrazolidine-3-carboxylic acid |
| SMILES | C=CCOC(=O)N1CC(O)C(C(=O)O)N1C(=O)OCC=C |
| InChI | InChI=1S/C12H16N2O7/c1-3-5-20-11(18)13-7-8(15)9(10(16)17)14(13)12(19)21-6-4-2/h3-4,8-9,15H,1-2,5-7H2,(H,16,17) |
| InChIKey | PRNGTDZCVNTHFK-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|