C20H36O5 — CID 139760851
dipropan-2-yl (2S,3R)-2-hydroxy-3-(8-methylnon-2-enyl)butanedioate (PubChem CID 139760851) has the molecular formula C20H36O5 and a molecular weight of 356.50 g/mol. Its IUPAC name is dipropan-2-yl (2S,3R)-2-hydroxy-3-(8-methylnon-2-enyl)butanedioate.
| Compound Name | dipropan-2-yl (2S,3R)-2-hydroxy-3-(8-methylnon-2-enyl)butanedioate |
|---|---|
| PubChem CID | 139760851 |
| Molecular Formula | C20H36O5 |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | dipropan-2-yl (2S,3R)-2-hydroxy-3-(8-methylnon-2-enyl)butanedioate |
| SMILES | CC(C)CCCCC=CC[C@@H](C(=O)OC(C)C)[C@H](O)C(=O)OC(C)C |
| InChI | InChI=1S/C20H36O5/c1-14(2)12-10-8-7-9-11-13-17(19(22)24-15(3)4)18(21)20(23)25-16(5)6/h9,11,14-18,21H,7-8,10,12-13H2,1-6H3/t17-,18+/m1/s1 |
| InChIKey | DHGNUSSQBLXFCG-MSOLQXFVSA-N |
| XLogP | 4.03 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|