C18H16O3 — CID 139763910
3-[5-(3-hydroxyphenyl)-3,4-dimethylfuran-2-yl]phenol (PubChem CID 139763910) has the molecular formula C18H16O3 and a molecular weight of 280.32 g/mol. Its IUPAC name is 3-[5-(3-hydroxyphenyl)-3,4-dimethylfuran-2-yl]phenol.
| Compound Name | 3-[5-(3-hydroxyphenyl)-3,4-dimethylfuran-2-yl]phenol |
|---|---|
| PubChem CID | 139763910 |
| Molecular Formula | C18H16O3 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 3-[5-(3-hydroxyphenyl)-3,4-dimethylfuran-2-yl]phenol |
| SMILES | Cc1c(-c2cccc(O)c2)oc(-c2cccc(O)c2)c1C |
| InChI | InChI=1S/C18H16O3/c1-11-12(2)18(14-6-4-8-16(20)10-14)21-17(11)13-5-3-7-15(19)9-13/h3-10,19-20H,1-2H3 |
| InChIKey | SCFSNQWRGQGJEL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |