C13H14O2 — CID 139764535
2,2,4,7-tetramethylindene-1,3-dione (PubChem CID 139764535) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is 2,2,4,7-tetramethylindene-1,3-dione.
| Compound Name | 2,2,4,7-tetramethylindene-1,3-dione |
|---|---|
| PubChem CID | 139764535 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 2,2,4,7-tetramethylindene-1,3-dione |
| SMILES | Cc1ccc(C)c2c1C(=O)C(C)(C)C2=O |
| InChI | InChI=1S/C13H14O2/c1-7-5-6-8(2)10-9(7)11(14)13(3,4)12(10)15/h5-6H,1-4H3 |
| InChIKey | DPYKLNQJDMUBJP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|