C12H8Cl4N2O2S — CID 139764598
3-chloro-4-[3-[2-(2,2,2-trichloroethyl)oxiran-2-yl]phenoxy]-1,2,5-thiadiazole (PubChem CID 139764598) has the molecular formula C12H8Cl4N2O2S and a molecular weight of 386.09 g/mol. Its IUPAC name is 3-chloro-4-[3-[2-(2,2,2-trichloroethyl)oxiran-2-yl]phenoxy]-1,2,5-thiadiazole.
| Compound Name | 3-chloro-4-[3-[2-(2,2,2-trichloroethyl)oxiran-2-yl]phenoxy]-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 139764598 |
| Molecular Formula | C12H8Cl4N2O2S |
| Molecular Weight | 386.09 g/mol |
| Exact Mass | 383.91 |
| IUPAC Name | 3-chloro-4-[3-[2-(2,2,2-trichloroethyl)oxiran-2-yl]phenoxy]-1,2,5-thiadiazole |
| SMILES | Clc1nsnc1Oc1cccc(C2(CC(Cl)(Cl)Cl)CO2)c1 |
| InChI | InChI=1S/C12H8Cl4N2O2S/c13-9-10(18-21-17-9)20-8-3-1-2-7(4-8)11(6-19-11)5-12(14,15)16/h1-4H,5-6H2 |
| InChIKey | RVZYJWQFPAWAQW-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 47.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.09 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|