C23H30N2O4 — CID 139764695
tert-butyl N-[4-[1-[[4-(2-hydroxyethyl)benzoyl]amino]propyl]phenyl]carbamate (PubChem CID 139764695) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is tert-butyl N-[4-[1-[[4-(2-hydroxyethyl)benzoyl]amino]propyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[1-[[4-(2-hydroxyethyl)benzoyl]amino]propyl]phenyl]carbamate |
|---|---|
| PubChem CID | 139764695 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | tert-butyl N-[4-[1-[[4-(2-hydroxyethyl)benzoyl]amino]propyl]phenyl]carbamate |
| SMILES | CCC(NC(=O)c1ccc(CCO)cc1)c1ccc(NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C23H30N2O4/c1-5-20(25-21(27)18-8-6-16(7-9-18)14-15-26)17-10-12-19(13-11-17)24-22(28)29-23(2,3)4/h6-13,20,26H,5,14-15H2,1-4H3,(H,24,28)(H,25,27) |
| InChIKey | QJJBMVDUXJYAJK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |