C39H46N6O2 — CID 139765433
1-[5-(3,3-dimethylspiro[piperidine-2,3'-pyrido[3,2-f][1,4]benzoxazine]-1-yl)pentyl]-3,3-dimethylspiro[piperidine-2,3'-pyrido[3,2-f][1,4]benzoxazine] (PubChem CID 139765433) has the molecular formula C39H46N6O2 and a molecular weight of 630.84 g/mol. Its IUPAC name is 1-[5-(3,3-dimethylspiro[piperidine-2,3'-pyrido[3,2-f][1,4]benzoxazine]-1-yl)pentyl]-3,3-dimethylspiro[piperidine-2,3'-pyrido[3,2-f][1,4]benzoxazine].
| Compound Name | 1-[5-(3,3-dimethylspiro[piperidine-2,3'-pyrido[3,2-f][1,4]benzoxazine]-1-yl)pentyl]-3,3-dimethylspiro[piperidine-2,3'-pyrido[3,2-f][1,4]benzoxazine] |
|---|---|
| PubChem CID | 139765433 |
| Molecular Formula | C39H46N6O2 |
| Molecular Weight | 630.84 g/mol |
| Exact Mass | 630.37 |
| IUPAC Name | 1-[5-(3,3-dimethylspiro[piperidine-2,3'-pyrido[3,2-f][1,4]benzoxazine]-1-yl)pentyl]-3,3-dimethylspiro[piperidine-2,3'-pyrido[3,2-f][1,4]benzoxazine] |
| SMILES | CC1(C)CCCN(CCCCCN2CCCC(C)(C)C23C=Nc2c(ccc4ncccc24)O3)C12C=Nc1c(ccc3ncccc13)O2 |
| InChI | InChI=1S/C39H46N6O2/c1-36(2)18-10-24-44(38(36)26-42-34-28-12-8-20-40-30(28)14-16-32(34)46-38)22-6-5-7-23-45-25-11-19-37(3,4)39(45)27-43-35-29-13-9-21-41-31(29)15-17-33(35)47-39/h8-9,12-17,20-21,26-27H,5-7,10-11,18-19,22-25H2,1-4H3 |
| InChIKey | KSQDLTJLXPIBAC-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 75.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.84 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|