About 2-(4-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid
2-(4-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid (PubChem CID 139765780) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is 2-(4-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(4-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid |
| PubChem CID | 139765780 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 2-(4-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid |
| SMILES | C=C1C=C(OC)C=CC1CC(=O)O |
| InChI | InChI=1S/C10H12O3/c1-7-5-9(13-2)4-3-8(7)6-10(11)12/h3-5,8H,1,6H2,2H3,(H,11,12) |
| InChIKey | TVUKDPJKZRYJGE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid?
The IUPAC name of 2-(4-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid (CID 139765780) is 2-(4-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid.
What is the SMILES notation for 2-(4-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid?
The canonical SMILES for 2-(4-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid is C=C1C=C(OC)C=CC1CC(=O)O.
What is the InChIKey of 2-(4-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid?
The InChIKey is TVUKDPJKZRYJGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-7-5-9(13-2)4-3-8(7)6-10(11)12/h3-5,8H,1,6H2,2H3,(H,11,12).
What are the key properties of 2-(4-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid?
2-(4-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid has a molecular weight of 180.20 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetic acid is sourced from PubChem (CID 139765780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).