About methyl 2-(5-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetate
methyl 2-(5-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetate (PubChem CID 139765828) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is methyl 2-(5-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(5-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetate |
| PubChem CID | 139765828 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | methyl 2-(5-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetate |
| SMILES | C=C1C(OC)=CC=CC1CC(=O)OC |
| InChI | InChI=1S/C11H14O3/c1-8-9(7-11(12)14-3)5-4-6-10(8)13-2/h4-6,9H,1,7H2,2-3H3 |
| InChIKey | YDHNMTSAUUASIT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-(5-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(5-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetate?
The IUPAC name of methyl 2-(5-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetate (CID 139765828) is methyl 2-(5-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetate.
What is the SMILES notation for methyl 2-(5-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetate?
The canonical SMILES for methyl 2-(5-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetate is C=C1C(OC)=CC=CC1CC(=O)OC.
What is the InChIKey of methyl 2-(5-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetate?
The InChIKey is YDHNMTSAUUASIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c1-8-9(7-11(12)14-3)5-4-6-10(8)13-2/h4-6,9H,1,7H2,2-3H3.
What are the key properties of methyl 2-(5-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetate?
methyl 2-(5-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetate has a molecular weight of 194.23 g/mol, XLogP of 1.82, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(5-methoxy-6-methylidenecyclohexa-2,4-dien-1-yl)acetate is sourced from PubChem (CID 139765828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).