C36H35BF15NO3Si — CID 139766391
dimethyl(phenyl)azanium;tris[(2,3,4,5,6-pentafluorophenyl)methyl]-(triethoxysilylmethyl)boranuide (PubChem CID 139766391) has the molecular formula C36H35BF15NO3Si and a molecular weight of 853.55 g/mol. Its IUPAC name is dimethyl(phenyl)azanium;tris[(2,3,4,5,6-pentafluorophenyl)methyl]-(triethoxysilylmethyl)boranuide.
| Compound Name | dimethyl(phenyl)azanium;tris[(2,3,4,5,6-pentafluorophenyl)methyl]-(triethoxysilylmethyl)boranuide |
|---|---|
| PubChem CID | 139766391 |
| Molecular Formula | C36H35BF15NO3Si |
| Molecular Weight | 853.55 g/mol |
| Exact Mass | 853.22 |
| IUPAC Name | dimethyl(phenyl)azanium;tris[(2,3,4,5,6-pentafluorophenyl)methyl]-(triethoxysilylmethyl)boranuide |
| SMILES | CCO[Si](C[B-](Cc1c(F)c(F)c(F)c(F)c1F)(Cc1c(F)c(F)c(F)c(F)c1F)Cc1c(F)c(F)c(F)c(F)c1F)(OCC)OCC.C[NH+](C)c1ccccc1 |
| InChI | InChI=1S/C28H23BF15O3Si.C8H11N/c1-4-45-48(46-5-2,47-6-3)10-29(7-11-14(30)20(36)26(42)21(37)15(11)31,8-12-16(32)22(38)27(43)23(39)17(12)33)9-13-18(34)24(40)28(44)25(41)19(13)35;1-9(2)8-6-4-3-5-7-8/h4-10H2,1-3H3;3-7H,1-2H3/q-1;/p+1 |
| InChIKey | SGJYRNYFWLVYLS-UHFFFAOYSA-O |
| XLogP | 8.92 |
| TPSA | 32.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.55 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|