C32H26O8 — CID 139767347
4,9,10,15,20,21-hexamethoxyhexacyclo[12.12.0.02,7.08,13.016,25.018,23]hexacosa-1,4,6,8,10,13,15,17,19,21,23,25-dodecaene-3,12-dione (PubChem CID 139767347) has the molecular formula C32H26O8 and a molecular weight of 538.55 g/mol. Its IUPAC name is 4,9,10,15,20,21-hexamethoxyhexacyclo[12.12.0.02,7.08,13.016,25.018,23]hexacosa-1,4,6,8,10,13,15,17,19,21,23,25-dodecaene-3,12-dione.
| Compound Name | 4,9,10,15,20,21-hexamethoxyhexacyclo[12.12.0.02,7.08,13.016,25.018,23]hexacosa-1,4,6,8,10,13,15,17,19,21,23,25-dodecaene-3,12-dione |
|---|---|
| PubChem CID | 139767347 |
| Molecular Formula | C32H26O8 |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | 4,9,10,15,20,21-hexamethoxyhexacyclo[12.12.0.02,7.08,13.016,25.018,23]hexacosa-1,4,6,8,10,13,15,17,19,21,23,25-dodecaene-3,12-dione |
| SMILES | COC1=CC=c2c(c3cc4cc5cc(OC)c(OC)cc5cc4c(OC)c3c3c2=C(OC)C(OC)=CC3=O)C1=O |
| InChI | InChI=1S/C32H26O8/c1-35-22-8-7-18-26(30(22)34)20-11-17-9-15-12-23(36-2)24(37-3)13-16(15)10-19(17)31(39-5)28(20)29-21(33)14-25(38-4)32(40-6)27(18)29/h7-14H,1-6H3 |
| InChIKey | SFNPCEYVROKLFU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|