C30H45BO3 — CID 139768639
tris[(5R)-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl] borate (PubChem CID 139768639) has the molecular formula C30H45BO3 and a molecular weight of 464.50 g/mol. Its IUPAC name is tris[(5R)-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl] borate.
| Compound Name | tris[(5R)-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl] borate |
|---|---|
| PubChem CID | 139768639 |
| Molecular Formula | C30H45BO3 |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.35 |
| IUPAC Name | tris[(5R)-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl] borate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C(OB(OC2=C(C)CC[C@@H](C(=C)C)C2)OC2=C(C)CC[C@@H](C(=C)C)C2)C1 |
| InChI | InChI=1S/C30H45BO3/c1-19(2)25-13-10-22(7)28(16-25)32-31(33-29-17-26(20(3)4)14-11-23(29)8)34-30-18-27(21(5)6)15-12-24(30)9/h25-27H,1,3,5,10-18H2,2,4,6-9H3/t25-,26-,27-/m1/s1 |
| InChIKey | SODGXRUUZNHVRH-ZONZVBGPSA-N |
| XLogP | 8.97 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|