About tris[(5R)-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl] borate
tris[(5R)-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl] borate (PubChem CID 139768639) has the molecular formula C30H45BO3
and a molecular weight of 464.50 g/mol. Its IUPAC name is tris[(5R)-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl] borate.
Molecular Properties
| Compound Name | tris[(5R)-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl] borate |
| PubChem CID | 139768639 |
| Molecular Formula | C30H45BO3 |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.35 |
| IUPAC Name | tris[(5R)-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl] borate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C(OB(OC2=C(C)CC[C@@H](C(=C)C)C2)OC2=C(C)CC[C@@H](C(=C)C)C2)C1 |
| InChI | InChI=1S/C30H45BO3/c1-19(2)25-13-10-22(7)28(16-25)32-31(33-29-17-26(20(3)4)14-11-23(29)8)34-30-18-27(21(5)6)15-12-24(30)9/h25-27H,1,3,5,10-18H2,2,4,6-9H3/t25-,26-,27-/m1/s1 |
| InChIKey | SODGXRUUZNHVRH-ZONZVBGPSA-N |
| XLogP | 8.97 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tris[(5R)-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl] borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris[(5R)-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl] borate?
The IUPAC name of tris[(5R)-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl] borate (CID 139768639) is tris[(5R)-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl] borate.
What is the SMILES notation for tris[(5R)-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl] borate?
The canonical SMILES for tris[(5R)-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl] borate is C=C(C)[C@@H]1CCC(C)=C(OB(OC2=C(C)CC[C@@H](C(=C)C)C2)OC2=C(C)CC[C@@H](C(=C)C)C2)C1.
What is the InChIKey of tris[(5R)-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl] borate?
The InChIKey is SODGXRUUZNHVRH-ZONZVBGPSA-N. The full InChI is InChI=1S/C30H45BO3/c1-19(2)25-13-10-22(7)28(16-25)32-31(33-29-17-26(20(3)4)14-11-23(29)8)34-30-18-27(21(5)6)15-12-24(30)9/h25-27H,1,3,5,10-18H2,2,4,6-9H3/t25-,26-,27-/m1/s1.
What are the key properties of tris[(5R)-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl] borate?
tris[(5R)-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl] borate has a molecular weight of 464.50 g/mol, XLogP of 8.97, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tris[(5R)-2-methyl-5-prop-1-en-2-ylcyclohexen-1-yl] borate is sourced from PubChem (CID 139768639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).