C18H38N4O — CID 139768659
2,2,3-trimethyl-1-[2-[2-(2,2,3-trimethylpiperazin-1-yl)ethoxy]ethyl]piperazine (PubChem CID 139768659) has the molecular formula C18H38N4O and a molecular weight of 326.53 g/mol. Its IUPAC name is 2,2,3-trimethyl-1-[2-[2-(2,2,3-trimethylpiperazin-1-yl)ethoxy]ethyl]piperazine.
| Compound Name | 2,2,3-trimethyl-1-[2-[2-(2,2,3-trimethylpiperazin-1-yl)ethoxy]ethyl]piperazine |
|---|---|
| PubChem CID | 139768659 |
| Molecular Formula | C18H38N4O |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.30 |
| IUPAC Name | 2,2,3-trimethyl-1-[2-[2-(2,2,3-trimethylpiperazin-1-yl)ethoxy]ethyl]piperazine |
| SMILES | CC1NCCN(CCOCCN2CCNC(C)C2(C)C)C1(C)C |
| InChI | InChI=1S/C18H38N4O/c1-15-17(3,4)21(9-7-19-15)11-13-23-14-12-22-10-8-20-16(2)18(22,5)6/h15-16,19-20H,7-14H2,1-6H3 |
| InChIKey | GRSRRTUVNYOPRU-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 39.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|