C35H41O4+ — CID 139768920
2,4,6-tris[4-[(2-methylpropan-2-yl)oxy]phenyl]pyrylium (PubChem CID 139768920) has the molecular formula C35H41O4+ and a molecular weight of 525.71 g/mol. Its IUPAC name is 2,4,6-tris[4-[(2-methylpropan-2-yl)oxy]phenyl]pyrylium.
| Compound Name | 2,4,6-tris[4-[(2-methylpropan-2-yl)oxy]phenyl]pyrylium |
|---|---|
| PubChem CID | 139768920 |
| Molecular Formula | C35H41O4+ |
| Molecular Weight | 525.71 g/mol |
| Exact Mass | 525.30 |
| IUPAC Name | 2,4,6-tris[4-[(2-methylpropan-2-yl)oxy]phenyl]pyrylium |
| SMILES | CC(C)(C)Oc1ccc(-c2cc(-c3ccc(OC(C)(C)C)cc3)[o+]c(-c3ccc(OC(C)(C)C)cc3)c2)cc1 |
| InChI | InChI=1S/C35H41O4/c1-33(2,3)37-28-16-10-24(11-17-28)27-22-31(25-12-18-29(19-13-25)38-34(4,5)6)36-32(23-27)26-14-20-30(21-15-26)39-35(7,8)9/h10-23H,1-9H3/q+1 |
| InChIKey | GLDYGGSLZLXHSS-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 38.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.71 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|