C10H9F3O3 — CID 139769365
1-(3-ethylfuran-2-yl)-4,4,4-trifluorobutane-1,3-dione (PubChem CID 139769365) has the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. Its IUPAC name is 1-(3-ethylfuran-2-yl)-4,4,4-trifluorobutane-1,3-dione.
| Compound Name | 1-(3-ethylfuran-2-yl)-4,4,4-trifluorobutane-1,3-dione |
|---|---|
| PubChem CID | 139769365 |
| Molecular Formula | C10H9F3O3 |
| Molecular Weight | 234.17 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 1-(3-ethylfuran-2-yl)-4,4,4-trifluorobutane-1,3-dione |
| SMILES | CCc1ccoc1C(=O)CC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H9F3O3/c1-2-6-3-4-16-9(6)7(14)5-8(15)10(11,12)13/h3-4H,2,5H2,1H3 |
| InChIKey | NRLWIVOSQFCLIR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.17 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|