About 6-methyl-1,2-dioxa-6-azaspiro[2.4]heptan-7-one
6-methyl-1,2-dioxa-6-azaspiro[2.4]heptan-7-one (PubChem CID 139769508) has the molecular formula C5H7NO3
and a molecular weight of 129.11 g/mol. Its IUPAC name is 6-methyl-1,2-dioxa-6-azaspiro[2.4]heptan-7-one.
Molecular Properties
| Compound Name | 6-methyl-1,2-dioxa-6-azaspiro[2.4]heptan-7-one |
| PubChem CID | 139769508 |
| Molecular Formula | C5H7NO3 |
| Molecular Weight | 129.11 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | 6-methyl-1,2-dioxa-6-azaspiro[2.4]heptan-7-one |
| SMILES | CN1CCC2(OO2)C1=O |
| InChI | InChI=1S/C5H7NO3/c1-6-3-2-5(4(6)7)8-9-5/h2-3H2,1H3 |
| InChIKey | XXQLBYLWETXFMK-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 45.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.11 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-1,2-dioxa-6-azaspiro[2.4]heptan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1,2-dioxa-6-azaspiro[2.4]heptan-7-one?
The IUPAC name of 6-methyl-1,2-dioxa-6-azaspiro[2.4]heptan-7-one (CID 139769508) is 6-methyl-1,2-dioxa-6-azaspiro[2.4]heptan-7-one.
What is the SMILES notation for 6-methyl-1,2-dioxa-6-azaspiro[2.4]heptan-7-one?
The canonical SMILES for 6-methyl-1,2-dioxa-6-azaspiro[2.4]heptan-7-one is CN1CCC2(OO2)C1=O.
What is the InChIKey of 6-methyl-1,2-dioxa-6-azaspiro[2.4]heptan-7-one?
The InChIKey is XXQLBYLWETXFMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO3/c1-6-3-2-5(4(6)7)8-9-5/h2-3H2,1H3.
What are the key properties of 6-methyl-1,2-dioxa-6-azaspiro[2.4]heptan-7-one?
6-methyl-1,2-dioxa-6-azaspiro[2.4]heptan-7-one has a molecular weight of 129.11 g/mol, XLogP of -0.49, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1,2-dioxa-6-azaspiro[2.4]heptan-7-one is sourced from PubChem (CID 139769508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).