C18H21N3O5 — CID 1397700
5-(cyclopropyliminomethyl)-1-[2-(3,4-dimethoxyphenyl)ethyl]-6-hydroxypyrimidine-2,4-dione (PubChem CID 1397700) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is 5-(cyclopropyliminomethyl)-1-[2-(3,4-dimethoxyphenyl)ethyl]-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 5-(cyclopropyliminomethyl)-1-[2-(3,4-dimethoxyphenyl)ethyl]-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 1397700 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 5-(cyclopropyliminomethyl)-1-[2-(3,4-dimethoxyphenyl)ethyl]-6-hydroxypyrimidine-2,4-dione |
| SMILES | COc1ccc(CCn2c(O)c(/C=N/C3CC3)c(=O)[nH]c2=O)cc1OC |
| InChI | InChI=1S/C18H21N3O5/c1-25-14-6-3-11(9-15(14)26-2)7-8-21-17(23)13(10-19-12-4-5-12)16(22)20-18(21)24/h3,6,9-10,12,23H,4-5,7-8H2,1-2H3,(H,20,22,24)/b19-10+ |
| InChIKey | AXWLEMFQOMXSQY-VXLYETTFSA-N |
| XLogP | 1.08 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|