C36H39N3O7 — CID 139770066
N-[4-[2-[(3,4-dimethoxyphenyl)methyl-methylamino]ethyl]phenyl]-2-(6,7,8-trimethoxy-9-oxo-10H-acridin-4-yl)acetamide (PubChem CID 139770066) has the molecular formula C36H39N3O7 and a molecular weight of 625.72 g/mol. Its IUPAC name is N-[4-[2-[(3,4-dimethoxyphenyl)methyl-methylamino]ethyl]phenyl]-2-(6,7,8-trimethoxy-9-oxo-10H-acridin-4-yl)acetamide.
| Compound Name | N-[4-[2-[(3,4-dimethoxyphenyl)methyl-methylamino]ethyl]phenyl]-2-(6,7,8-trimethoxy-9-oxo-10H-acridin-4-yl)acetamide |
|---|---|
| PubChem CID | 139770066 |
| Molecular Formula | C36H39N3O7 |
| Molecular Weight | 625.72 g/mol |
| Exact Mass | 625.28 |
| IUPAC Name | N-[4-[2-[(3,4-dimethoxyphenyl)methyl-methylamino]ethyl]phenyl]-2-(6,7,8-trimethoxy-9-oxo-10H-acridin-4-yl)acetamide |
| SMILES | COc1ccc(CN(C)CCc2ccc(NC(=O)Cc3cccc4c(=O)c5c(OC)c(OC)c(OC)cc5[nH]c34)cc2)cc1OC |
| InChI | InChI=1S/C36H39N3O7/c1-39(21-23-12-15-28(42-2)29(18-23)43-3)17-16-22-10-13-25(14-11-22)37-31(40)19-24-8-7-9-26-33(24)38-27-20-30(44-4)35(45-5)36(46-6)32(27)34(26)41/h7-15,18,20H,16-17,19,21H2,1-6H3,(H,37,40)(H,38,41) |
| InChIKey | LPUAVLBFBHZFIA-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.72 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|