C14H16N2O — CID 139770443
3-(1,5-dimethyl-2,3-dihydroinden-1-yl)-1,2-oxazol-4-amine (PubChem CID 139770443) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is 3-(1,5-dimethyl-2,3-dihydroinden-1-yl)-1,2-oxazol-4-amine.
| Compound Name | 3-(1,5-dimethyl-2,3-dihydroinden-1-yl)-1,2-oxazol-4-amine |
|---|---|
| PubChem CID | 139770443 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 3-(1,5-dimethyl-2,3-dihydroinden-1-yl)-1,2-oxazol-4-amine |
| SMILES | Cc1ccc2c(c1)CCC2(C)c1nocc1N |
| InChI | InChI=1S/C14H16N2O/c1-9-3-4-11-10(7-9)5-6-14(11,2)13-12(15)8-17-16-13/h3-4,7-8H,5-6,15H2,1-2H3 |
| InChIKey | XHFDSVJRTLJGGC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |