C13H13ClN2O — CID 139771016
6-(4-chlorophenyl)-4,5,6,7-tetrahydro-2,1-benzoxazol-3-amine (PubChem CID 139771016) has the molecular formula C13H13ClN2O and a molecular weight of 248.71 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-4,5,6,7-tetrahydro-2,1-benzoxazol-3-amine.
| Compound Name | 6-(4-chlorophenyl)-4,5,6,7-tetrahydro-2,1-benzoxazol-3-amine |
|---|---|
| PubChem CID | 139771016 |
| Molecular Formula | C13H13ClN2O |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 6-(4-chlorophenyl)-4,5,6,7-tetrahydro-2,1-benzoxazol-3-amine |
| SMILES | Nc1onc2c1CCC(c1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C13H13ClN2O/c14-10-4-1-8(2-5-10)9-3-6-11-12(7-9)16-17-13(11)15/h1-2,4-5,9H,3,6-7,15H2 |
| InChIKey | CXRGVZWWQXMHKB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |